C21H18F2N2O4S — CID 133341183
N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]-4-methyl-2-nitroaniline (PubChem CID 133341183) has the molecular formula C21H18F2N2O4S and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]-4-methyl-2-nitroaniline.
| Compound Name | N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]-4-methyl-2-nitroaniline |
|---|---|
| PubChem CID | 133341183 |
| Molecular Formula | C21H18F2N2O4S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]-4-methyl-2-nitroaniline |
| SMILES | Cc1ccc(NC(c2cccc(S(C)(=O)=O)c2)c2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18F2N2O4S/c1-13-6-9-19(20(10-13)25(26)27)24-21(15-7-8-17(22)18(23)12-15)14-4-3-5-16(11-14)30(2,28)29/h3-12,21,24H,1-2H3 |
| InChIKey | HJUGGUILPNYGSL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|