C14H11F2N3O4 — CID 84929910
N-[1-(3,4-difluorophenyl)ethyl]-2,4-dinitroaniline (PubChem CID 84929910) has the molecular formula C14H11F2N3O4 and a molecular weight of 323.26 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2,4-dinitroaniline.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 84929910 |
| Molecular Formula | C14H11F2N3O4 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2,4-dinitroaniline |
| SMILES | CC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11F2N3O4/c1-8(9-2-4-11(15)12(16)6-9)17-13-5-3-10(18(20)21)7-14(13)19(22)23/h2-8,17H,1H3 |
| InChIKey | IJTDVRXFRTVLCL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|