C13H21N3O4S — CID 62144129
N-ethyl-4-(methylamino)-N-(2-methylpropyl)-3-nitrobenzenesulfonamide (PubChem CID 62144129) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-ethyl-4-(methylamino)-N-(2-methylpropyl)-3-nitrobenzenesulfonamide.
| Compound Name | N-ethyl-4-(methylamino)-N-(2-methylpropyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62144129 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-ethyl-4-(methylamino)-N-(2-methylpropyl)-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC(C)C)S(=O)(=O)c1ccc(NC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H21N3O4S/c1-5-15(9-10(2)3)21(19,20)11-6-7-12(14-4)13(8-11)16(17)18/h6-8,10,14H,5,9H2,1-4H3 |
| InChIKey | DSYDWLJSGNMZGH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|