C14H22N2O5S — CID 7680375
N,N-diethyl-4-(2-methylpropoxy)-3-nitrobenzenesulfonamide (PubChem CID 7680375) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is N,N-diethyl-4-(2-methylpropoxy)-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-(2-methylpropoxy)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7680375 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N,N-diethyl-4-(2-methylpropoxy)-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N2O5S/c1-5-15(6-2)22(19,20)12-7-8-14(21-10-11(3)4)13(9-12)16(17)18/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | IOFFJXSMTLOMQA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|