C16H16Cl2N2O6S2 — CID 24518504
4-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 24518504) has the molecular formula C16H16Cl2N2O6S2 and a molecular weight of 467.35 g/mol. Its IUPAC name is 4-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24518504 |
| Molecular Formula | C16H16Cl2N2O6S2 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 4-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(=O)c2cc(Cl)sc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16Cl2N2O6S2/c1-3-19(4-2)28(24,25)10-5-6-14(12(7-10)20(22)23)26-9-13(21)11-8-15(17)27-16(11)18/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | KXIWYFSYLAJVPO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|