C16H17ClN2O6S2 — CID 3948811
4-[2-(5-chlorothiophen-2-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 3948811) has the molecular formula C16H17ClN2O6S2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 4-[2-(5-chlorothiophen-2-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(5-chlorothiophen-2-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3948811 |
| Molecular Formula | C16H17ClN2O6S2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 4-[2-(5-chlorothiophen-2-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(=O)c2ccc(Cl)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17ClN2O6S2/c1-3-18(4-2)27(23,24)11-5-6-14(12(9-11)19(21)22)25-10-13(20)15-7-8-16(17)26-15/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | QDSVGYRSVYGSHC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|