C16H22N2O4 — CID 31885314
1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone (PubChem CID 31885314) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone.
| Compound Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 31885314 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone |
| SMILES | Cc1ccc([N+](=O)[O-])c(OCC(=O)N2[C@@H](C)CCC[C@@H]2C)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-11-7-8-14(18(20)21)15(9-11)22-10-16(19)17-12(2)5-4-6-13(17)3/h7-9,12-13H,4-6,10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ZSPAWYJVAOFTJO-STQMWFEESA-N |
| XLogP | 3.07 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|