C15H19F2NO2 — CID 42891275
2-(2,4-difluorophenoxy)-1-(2,6-dimethylpiperidin-1-yl)ethanone (PubChem CID 42891275) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-1-(2,6-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 2-(2,4-difluorophenoxy)-1-(2,6-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 42891275 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-1-(2,6-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCC(C)N1C(=O)COc1ccc(F)cc1F |
| InChI | InChI=1S/C15H19F2NO2/c1-10-4-3-5-11(2)18(10)15(19)9-20-14-7-6-12(16)8-13(14)17/h6-8,10-11H,3-5,9H2,1-2H3 |
| InChIKey | JIVNTEWULIMARB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |