C14H18F2N2O2 — CID 119489358
2-(2,4-difluorophenoxy)-1-[3-(methylamino)piperidin-1-yl]ethanone (PubChem CID 119489358) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-1-[3-(methylamino)piperidin-1-yl]ethanone.
| Compound Name | 2-(2,4-difluorophenoxy)-1-[3-(methylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119489358 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-1-[3-(methylamino)piperidin-1-yl]ethanone |
| SMILES | CNC1CCCN(C(=O)COc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H18F2N2O2/c1-17-11-3-2-6-18(8-11)14(19)9-20-13-5-4-10(15)7-12(13)16/h4-5,7,11,17H,2-3,6,8-9H2,1H3 |
| InChIKey | MTOBTABQYXPPGM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |