C22H26FN3O4 — CID 22265102
1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone (PubChem CID 22265102) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 22265102 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(5-methyl-2-nitrophenoxy)ethanone |
| SMILES | Cc1ccc([N+](=O)[O-])c(OCC(=O)N2CC(C)N(Cc3ccc(F)cc3)CC2C)c1 |
| InChI | InChI=1S/C22H26FN3O4/c1-15-4-9-20(26(28)29)21(10-15)30-14-22(27)25-12-16(2)24(11-17(25)3)13-18-5-7-19(23)8-6-18/h4-10,16-17H,11-14H2,1-3H3 |
| InChIKey | KZZDVJNFGFZEMS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|