C21H23FN4O6 — CID 87772179
2-(2,6-dinitrophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 87772179) has the molecular formula C21H23FN4O6 and a molecular weight of 446.44 g/mol. Its IUPAC name is 2-(2,6-dinitrophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2,6-dinitrophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 87772179 |
| Molecular Formula | C21H23FN4O6 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-(2,6-dinitrophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)COc2c([N+](=O)[O-])cccc2[N+](=O)[O-])[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN4O6/c1-14-11-24(15(2)10-23(14)12-16-6-8-17(22)9-7-16)20(27)13-32-21-18(25(28)29)4-3-5-19(21)26(30)31/h3-9,14-15H,10-13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | ZLIZNBCKMVMTKQ-CABCVRRESA-N |
| XLogP | 3.14 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|