C22H24FN3O6 — CID 54523571
3-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-nitrobenzoic acid (PubChem CID 54523571) has the molecular formula C22H24FN3O6 and a molecular weight of 445.45 g/mol. Its IUPAC name is 3-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-nitrobenzoic acid.
| Compound Name | 3-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 54523571 |
| Molecular Formula | C22H24FN3O6 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-nitrobenzoic acid |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1cccc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24FN3O6/c1-14-11-25(15(2)10-24(14)12-16-6-8-17(23)9-7-16)20(27)13-32-19-5-3-4-18(22(28)29)21(19)26(30)31/h3-9,14-15H,10-13H2,1-2H3,(H,28,29)/t14-,15+/m0/s1 |
| InChIKey | YRNUVWMXWVTCDN-LSDHHAIUSA-N |
| XLogP | 2.93 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|