C22H23FN4O8 — CID 22263763
2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-dinitrobenzoic acid (PubChem CID 22263763) has the molecular formula C22H23FN4O8 and a molecular weight of 490.44 g/mol. Its IUPAC name is 2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-dinitrobenzoic acid.
| Compound Name | 2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 22263763 |
| Molecular Formula | C22H23FN4O8 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-dinitrobenzoic acid |
| SMILES | CC1CN(C(=O)COc2c(C(=O)O)cc([N+](=O)[O-])cc2[N+](=O)[O-])C(C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN4O8/c1-13-10-25(14(2)9-24(13)11-15-3-5-16(23)6-4-15)20(28)12-35-21-18(22(29)30)7-17(26(31)32)8-19(21)27(33)34/h3-8,13-14H,9-12H2,1-2H3,(H,29,30) |
| InChIKey | NMQWZMFBHHTYHE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|