C25H25FN4O6 — CID 87771861
2-(2,4-dinitronaphthalen-1-yl)oxy-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 87771861) has the molecular formula C25H25FN4O6 and a molecular weight of 496.50 g/mol. Its IUPAC name is 2-(2,4-dinitronaphthalen-1-yl)oxy-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-dinitronaphthalen-1-yl)oxy-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 87771861 |
| Molecular Formula | C25H25FN4O6 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-(2,4-dinitronaphthalen-1-yl)oxy-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)COc2c([N+](=O)[O-])cc([N+](=O)[O-])c3ccccc23)[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H25FN4O6/c1-16-13-28(17(2)12-27(16)14-18-7-9-19(26)10-8-18)24(31)15-36-25-21-6-4-3-5-20(21)22(29(32)33)11-23(25)30(34)35/h3-11,16-17H,12-15H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | VGCQBZBLKQMZJT-SJORKVTESA-N |
| XLogP | 4.30 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|