C22H23BrFN3O5 — CID 54448421
5-bromo-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3-nitrobenzaldehyde (PubChem CID 54448421) has the molecular formula C22H23BrFN3O5 and a molecular weight of 508.34 g/mol. Its IUPAC name is 5-bromo-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3-nitrobenzaldehyde.
| Compound Name | 5-bromo-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 54448421 |
| Molecular Formula | C22H23BrFN3O5 |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 5-bromo-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3-nitrobenzaldehyde |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1c(C=O)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23BrFN3O5/c1-14-10-26(15(2)9-25(14)11-16-3-5-19(24)6-4-16)21(29)13-32-22-17(12-28)7-18(23)8-20(22)27(30)31/h3-8,12,14-15H,9-11,13H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | WTFBMWRBYYMTDP-LSDHHAIUSA-N |
| XLogP | 3.81 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|