C22H25FN4O6 — CID 87771498
1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-methyl-2,6-dinitrophenoxy)ethanone (PubChem CID 87771498) has the molecular formula C22H25FN4O6 and a molecular weight of 460.46 g/mol. Its IUPAC name is 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-methyl-2,6-dinitrophenoxy)ethanone.
| Compound Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-methyl-2,6-dinitrophenoxy)ethanone |
|---|---|
| PubChem CID | 87771498 |
| Molecular Formula | C22H25FN4O6 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-methyl-2,6-dinitrophenoxy)ethanone |
| SMILES | Cc1cc([N+](=O)[O-])c(OCC(=O)N2C[C@@H](C)N(Cc3ccc(F)cc3)C[C@@H]2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25FN4O6/c1-14-8-19(26(29)30)22(20(9-14)27(31)32)33-13-21(28)25-11-15(2)24(10-16(25)3)12-17-4-6-18(23)7-5-17/h4-9,15-16H,10-13H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | IYUVZVCSBOFWTN-CVEARBPZSA-N |
| XLogP | 3.45 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|