C22H23F4N3O4 — CID 54124378
1-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanone (PubChem CID 54124378) has the molecular formula C22H23F4N3O4 and a molecular weight of 469.44 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanone.
| Compound Name | 1-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 54124378 |
| Molecular Formula | C22H23F4N3O4 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 1-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanone |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F4N3O4/c1-14-11-28(15(2)10-27(14)12-16-3-5-17(23)6-4-16)21(30)13-33-18-7-8-20(29(31)32)19(9-18)22(24,25)26/h3-9,14-15H,10-13H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | NPXYCPYNJAQZRD-LSDHHAIUSA-N |
| XLogP | 4.25 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|