C21H24Br2FN3O2 — CID 69299251
2-(4-amino-2,6-dibromophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 69299251) has the molecular formula C21H24Br2FN3O2 and a molecular weight of 529.25 g/mol. Its IUPAC name is 2-(4-amino-2,6-dibromophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-amino-2,6-dibromophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 69299251 |
| Molecular Formula | C21H24Br2FN3O2 |
| Molecular Weight | 529.25 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | 2-(4-amino-2,6-dibromophenoxy)-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)COc2c(Br)cc(N)cc2Br)[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H24Br2FN3O2/c1-13-10-27(14(2)9-26(13)11-15-3-5-16(24)6-4-15)20(28)12-29-21-18(22)7-17(25)8-19(21)23/h3-8,13-14H,9-12,25H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | VBGWLPMXBVOKBJ-KGLIPLIRSA-N |
| XLogP | 4.43 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|