C22H26FN3O4 — CID 22265227
5-amino-2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]benzoic acid (PubChem CID 22265227) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is 5-amino-2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]benzoic acid.
| Compound Name | 5-amino-2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 22265227 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 5-amino-2-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]benzoic acid |
| SMILES | CC1CN(C(=O)COc2ccc(N)cc2C(=O)O)C(C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN3O4/c1-14-11-26(15(2)10-25(14)12-16-3-5-17(23)6-4-16)21(27)13-30-20-8-7-18(24)9-19(20)22(28)29/h3-9,14-15H,10-13,24H2,1-2H3,(H,28,29) |
| InChIKey | JUIJXKIBZKECGZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|