C21H22F4N2O2 — CID 69297026
1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone (PubChem CID 69297026) has the molecular formula C21H22F4N2O2 and a molecular weight of 410.41 g/mol. Its IUPAC name is 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone.
| Compound Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone |
|---|---|
| PubChem CID | 69297026 |
| Molecular Formula | C21H22F4N2O2 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone |
| SMILES | C[C@@H]1CN(C(=O)COc2ccc(F)c(F)c2F)[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H22F4N2O2/c1-13-10-27(14(2)9-26(13)11-15-3-5-16(22)6-4-15)19(28)12-29-18-8-7-17(23)20(24)21(18)25/h3-8,13-14H,9-12H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | BXAVMWCGEGGUQF-KGLIPLIRSA-N |
| XLogP | 3.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|