C21H25FN2O2S — CID 69298429
1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2-sulfanylphenoxy)ethanone (PubChem CID 69298429) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2-sulfanylphenoxy)ethanone.
| Compound Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2-sulfanylphenoxy)ethanone |
|---|---|
| PubChem CID | 69298429 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(2-sulfanylphenoxy)ethanone |
| SMILES | C[C@@H]1CN(C(=O)COc2ccccc2S)[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O2S/c1-15-12-24(21(25)14-26-19-5-3-4-6-20(19)27)16(2)11-23(15)13-17-7-9-18(22)10-8-17/h3-10,15-16,27H,11-14H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | FMHQCXVERIYOBB-CVEARBPZSA-N |
| XLogP | 3.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|