C22H24FIN2O4 — CID 54325820
2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-5-iodobenzoic acid (PubChem CID 54325820) has the molecular formula C22H24FIN2O4 and a molecular weight of 526.35 g/mol. Its IUPAC name is 2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-5-iodobenzoic acid.
| Compound Name | 2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 54325820 |
| Molecular Formula | C22H24FIN2O4 |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-5-iodobenzoic acid |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C22H24FIN2O4/c1-14-11-26(15(2)10-25(14)12-16-3-5-17(23)6-4-16)21(27)13-30-20-8-7-18(24)9-19(20)22(28)29/h3-9,14-15H,10-13H2,1-2H3,(H,28,29)/t14-,15+/m0/s1 |
| InChIKey | SUVKNUATTJWQJD-LSDHHAIUSA-N |
| XLogP | 3.63 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|