C22H23FI2N2O4 — CID 22263790
4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-diiodobenzoic acid (PubChem CID 22263790) has the molecular formula C22H23FI2N2O4 and a molecular weight of 652.24 g/mol. Its IUPAC name is 4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-diiodobenzoic acid.
| Compound Name | 4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 22263790 |
| Molecular Formula | C22H23FI2N2O4 |
| Molecular Weight | 652.24 g/mol |
| Exact Mass | 651.97 |
| IUPAC Name | 4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-3,5-diiodobenzoic acid |
| SMILES | CC1CN(C(=O)COc2c(I)cc(C(=O)O)cc2I)C(C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FI2N2O4/c1-13-10-27(14(2)9-26(13)11-15-3-5-17(23)6-4-15)20(28)12-31-21-18(24)7-16(22(29)30)8-19(21)25/h3-8,13-14H,9-12H2,1-2H3,(H,29,30) |
| InChIKey | ROBHPRRNGIUSOJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|