C24H24FI2N3O2 — CID 22265254
2-(5,7-diiodoquinolin-8-yl)oxy-1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 22265254) has the molecular formula C24H24FI2N3O2 and a molecular weight of 659.28 g/mol. Its IUPAC name is 2-(5,7-diiodoquinolin-8-yl)oxy-1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-(5,7-diiodoquinolin-8-yl)oxy-1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 22265254 |
| Molecular Formula | C24H24FI2N3O2 |
| Molecular Weight | 659.28 g/mol |
| Exact Mass | 658.99 |
| IUPAC Name | 2-(5,7-diiodoquinolin-8-yl)oxy-1-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | CC1CN(C(=O)COc2c(I)cc(I)c3cccnc23)C(C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FI2N3O2/c1-15-12-30(16(2)11-29(15)13-17-5-7-18(25)8-6-17)22(31)14-32-24-21(27)10-20(26)19-4-3-9-28-23(19)24/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | DSXJGVRCMIIKTR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|