C24H26FN3O5S — CID 54273166
8-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]quinoline-5-sulfonic acid (PubChem CID 54273166) has the molecular formula C24H26FN3O5S and a molecular weight of 487.55 g/mol. Its IUPAC name is 8-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]quinoline-5-sulfonic acid.
| Compound Name | 8-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 54273166 |
| Molecular Formula | C24H26FN3O5S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 8-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]quinoline-5-sulfonic acid |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1ccc(S(=O)(=O)O)c2cccnc12 |
| InChI | InChI=1S/C24H26FN3O5S/c1-16-13-28(17(2)12-27(16)14-18-5-7-19(25)8-6-18)23(29)15-33-21-9-10-22(34(30,31)32)20-4-3-11-26-24(20)21/h3-11,16-17H,12-15H2,1-2H3,(H,30,31,32)/t16-,17+/m0/s1 |
| InChIKey | RLPAHAUZRAXODQ-DLBZAZTESA-N |
| XLogP | 3.12 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|