C25H27FN2O5S — CID 87772134
4-[2-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]naphthalene-1-sulfonic acid (PubChem CID 87772134) has the molecular formula C25H27FN2O5S and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-[2-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]naphthalene-1-sulfonic acid.
| Compound Name | 4-[2-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 87772134 |
| Molecular Formula | C25H27FN2O5S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 4-[2-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]naphthalene-1-sulfonic acid |
| SMILES | C[C@@H]1CN(C(=O)COc2ccc(S(=O)(=O)O)c3ccccc23)[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN2O5S/c1-17-14-28(18(2)13-27(17)15-19-7-9-20(26)10-8-19)25(29)16-33-23-11-12-24(34(30,31)32)22-6-4-3-5-21(22)23/h3-12,17-18H,13-16H2,1-2H3,(H,30,31,32)/t17-,18+/m1/s1 |
| InChIKey | MTDJPPXLKHZRJQ-MSOLQXFVSA-N |
| XLogP | 3.73 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|