C20H30N2O5S — CID 55313381
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 55313381) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55313381 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)N2C(C)CCCC2C)c1 |
| InChI | InChI=1S/C20H30N2O5S/c1-5-21(6-2)28(25,26)18-12-8-11-17(13-18)20(24)27-14-19(23)22-15(3)9-7-10-16(22)4/h8,11-13,15-16H,5-7,9-10,14H2,1-4H3 |
| InChIKey | KIZCUGMDCIUSRA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |