C27H31N3O9S — CID 166522715
4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-5-nitrobenzenesulfonamide (PubChem CID 166522715) has the molecular formula C27H31N3O9S and a molecular weight of 573.62 g/mol. Its IUPAC name is 4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-5-nitrobenzenesulfonamide.
| Compound Name | 4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 166522715 |
| Molecular Formula | C27H31N3O9S |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2cc(O)c(NC[C@H]3COCCO3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H31N3O9S/c1-36-21-7-3-19(4-8-21)16-29(17-20-5-9-22(37-2)10-6-20)40(34,35)24-13-25(30(32)33)27(26(31)14-24)28-15-23-18-38-11-12-39-23/h3-10,13-14,23,28,31H,11-12,15-18H2,1-2H3/t23-/m0/s1 |
| InChIKey | ZFFIUXGZGMMQND-QHCPKHFHSA-N |
| XLogP | 3.54 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|