C14H15N3O4 — CID 103964000
N-(1,4-dioxan-2-ylmethyl)-3-nitroquinolin-4-amine (PubChem CID 103964000) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-3-nitroquinolin-4-amine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 103964000 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-3-nitroquinolin-4-amine |
| SMILES | O=[N+]([O-])c1cnc2ccccc2c1NCC1COCCO1 |
| InChI | InChI=1S/C14H15N3O4/c18-17(19)13-8-15-12-4-2-1-3-11(12)14(13)16-7-10-9-20-5-6-21-10/h1-4,8,10H,5-7,9H2,(H,15,16) |
| InChIKey | OKTSMGHUVRWNTL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|