C11H13N3O6 — CID 81438444
6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carboxylic acid (PubChem CID 81438444) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is 6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81438444 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC2COCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O6/c15-11(16)7-3-9(14(17)18)10(12-4-7)13-5-8-6-19-1-2-20-8/h3-4,8H,1-2,5-6H2,(H,12,13)(H,15,16) |
| InChIKey | WTLNDKZPBODDPC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|