C6H6N4O4 — CID 82862825
6-hydrazinyl-5-nitropyridine-3-carboxylic acid (PubChem CID 82862825) has the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. Its IUPAC name is 6-hydrazinyl-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-hydrazinyl-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82862825 |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 6-hydrazinyl-5-nitropyridine-3-carboxylic acid |
| SMILES | NNc1ncc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N4O4/c7-9-5-4(10(13)14)1-3(2-8-5)6(11)12/h1-2H,7H2,(H,8,9)(H,11,12) |
| InChIKey | MUUMHICAZNBFHV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|