C8H10N4O4 — CID 81437835
6-(2-aminoethylamino)-5-nitropyridine-3-carboxylic acid (PubChem CID 81437835) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-(2-aminoethylamino)-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81437835 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 6-(2-aminoethylamino)-5-nitropyridine-3-carboxylic acid |
| SMILES | NCCNc1ncc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N4O4/c9-1-2-10-7-6(12(15)16)3-5(4-11-7)8(13)14/h3-4H,1-2,9H2,(H,10,11)(H,13,14) |
| InChIKey | ASOXOCFVUJCHGK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|