C12H15N3O5 — CID 81438043
5-nitro-6-[2-(oxolan-2-yl)ethylamino]pyridine-3-carboxylic acid (PubChem CID 81438043) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 5-nitro-6-[2-(oxolan-2-yl)ethylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-nitro-6-[2-(oxolan-2-yl)ethylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81438043 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-nitro-6-[2-(oxolan-2-yl)ethylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCC2CCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O5/c16-12(17)8-6-10(15(18)19)11(14-7-8)13-4-3-9-2-1-5-20-9/h6-7,9H,1-5H2,(H,13,14)(H,16,17) |
| InChIKey | DUIRUSUKMRFMIF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|