C11H13N3O6S — CID 81446708
6-[(1,1-dioxothiolan-2-yl)methylamino]-5-nitropyridine-3-carboxylic acid (PubChem CID 81446708) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-2-yl)methylamino]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-[(1,1-dioxothiolan-2-yl)methylamino]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81446708 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 6-[(1,1-dioxothiolan-2-yl)methylamino]-5-nitropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC2CCCS2(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O6S/c15-11(16)7-4-9(14(17)18)10(12-5-7)13-6-8-2-1-3-21(8,19)20/h4-5,8H,1-3,6H2,(H,12,13)(H,15,16) |
| InChIKey | HHYAEDJLOBDNGN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|