C10H9N3O6S — CID 81437711
6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-5-nitropyridine-3-carboxylic acid (PubChem CID 81437711) has the molecular formula C10H9N3O6S and a molecular weight of 299.26 g/mol. Its IUPAC name is 6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81437711 |
| Molecular Formula | C10H9N3O6S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-5-nitropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NC2C=CS(=O)(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9N3O6S/c14-10(15)6-3-8(13(16)17)9(11-4-6)12-7-1-2-20(18,19)5-7/h1-4,7H,5H2,(H,11,12)(H,14,15) |
| InChIKey | LDZPUTBBAMYQGM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|