C11H9FN2O5S — CID 60704767
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-fluoro-3-nitrobenzamide (PubChem CID 60704767) has the molecular formula C11H9FN2O5S and a molecular weight of 300.27 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-fluoro-3-nitrobenzamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 60704767 |
| Molecular Formula | C11H9FN2O5S |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-fluoro-3-nitrobenzamide |
| SMILES | O=C(NC1C=CS(=O)(=O)C1)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9FN2O5S/c12-9-2-1-7(5-10(9)14(16)17)11(15)13-8-3-4-20(18,19)6-8/h1-5,8H,6H2,(H,13,15) |
| InChIKey | BPHHVWLQIPXDIM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|