C11H9ClN2O5S — CID 60704660
5-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-nitrobenzamide (PubChem CID 60704660) has the molecular formula C11H9ClN2O5S and a molecular weight of 316.72 g/mol. Its IUPAC name is 5-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 60704660 |
| Molecular Formula | C11H9ClN2O5S |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 5-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-nitrobenzamide |
| SMILES | O=C(NC1C=CS(=O)(=O)C1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9ClN2O5S/c12-7-1-2-10(14(16)17)9(5-7)11(15)13-8-3-4-20(18,19)6-8/h1-5,8H,6H2,(H,13,15) |
| InChIKey | ZMPVGVSHVZMMKF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|