C10H9FN2O4S — CID 25468652
(3R)-N-(4-fluoro-2-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 25468652) has the molecular formula C10H9FN2O4S and a molecular weight of 272.26 g/mol. Its IUPAC name is (3R)-N-(4-fluoro-2-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | (3R)-N-(4-fluoro-2-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 25468652 |
| Molecular Formula | C10H9FN2O4S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (3R)-N-(4-fluoro-2-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=[N+]([O-])c1cc(F)ccc1N[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H9FN2O4S/c11-7-1-2-9(10(5-7)13(14)15)12-8-3-4-18(16,17)6-8/h1-5,8,12H,6H2/t8-/m1/s1 |
| InChIKey | CBJCSNMTRHFOCI-MRVPVSSYSA-N |
| XLogP | 1.46 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|