C11H8ClF3N2O4S — CID 9114084
(3S)-N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 9114084) has the molecular formula C11H8ClF3N2O4S and a molecular weight of 356.71 g/mol. Its IUPAC name is (3S)-N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | (3S)-N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 9114084 |
| Molecular Formula | C11H8ClF3N2O4S |
| Molecular Weight | 356.71 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | (3S)-N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)cc1N[C@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H8ClF3N2O4S/c12-8-4-9(16-6-1-2-22(20,21)5-6)10(17(18)19)3-7(8)11(13,14)15/h1-4,6,16H,5H2/t6-/m0/s1 |
| InChIKey | PEADSBROJLXVMP-LURJTMIESA-N |
| XLogP | 2.99 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|