C13H13ClF3N3O4 — CID 123421873
4-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid (PubChem CID 123421873) has the molecular formula C13H13ClF3N3O4 and a molecular weight of 367.71 g/mol. Its IUPAC name is 4-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid.
| Compound Name | 4-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123421873 |
| Molecular Formula | C13H13ClF3N3O4 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 4-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Nc2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H13ClF3N3O4/c14-9-6-10(11(20(23)24)5-8(9)13(15,16)17)18-7-1-3-19(4-2-7)12(21)22/h5-7,18H,1-4H2,(H,21,22) |
| InChIKey | SVPDHRVJRMCDTC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|