C14H16ClF3N2O3 — CID 133496347
2-[2-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]cyclopentyl]ethanol (PubChem CID 133496347) has the molecular formula C14H16ClF3N2O3 and a molecular weight of 352.74 g/mol. Its IUPAC name is 2-[2-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]cyclopentyl]ethanol.
| Compound Name | 2-[2-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]cyclopentyl]ethanol |
|---|---|
| PubChem CID | 133496347 |
| Molecular Formula | C14H16ClF3N2O3 |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[2-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]cyclopentyl]ethanol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)cc1NC1CCCC1CCO |
| InChI | InChI=1S/C14H16ClF3N2O3/c15-10-7-12(19-11-3-1-2-8(11)4-5-21)13(20(22)23)6-9(10)14(16,17)18/h6-8,11,19,21H,1-5H2 |
| InChIKey | UWWPBACVQHNGEF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|