C9H7ClF3N2O5P — CID 151585241
N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-2-hydroxy-2-oxo-1,2λ5-oxaphosphetan-4-amine (PubChem CID 151585241) has the molecular formula C9H7ClF3N2O5P and a molecular weight of 346.59 g/mol. Its IUPAC name is N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-2-hydroxy-2-oxo-1,2λ5-oxaphosphetan-4-amine.
| Compound Name | N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-2-hydroxy-2-oxo-1,2λ5-oxaphosphetan-4-amine |
|---|---|
| PubChem CID | 151585241 |
| Molecular Formula | C9H7ClF3N2O5P |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | N-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-2-hydroxy-2-oxo-1,2λ5-oxaphosphetan-4-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)cc1NC1CP(=O)(O)O1 |
| InChI | InChI=1S/C9H7ClF3N2O5P/c10-5-2-6(14-8-3-21(18,19)20-8)7(15(16)17)1-4(5)9(11,12)13/h1-2,8,14H,3H2,(H,18,19) |
| InChIKey | QHIVRBIUOUBWDC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|