C11H8ClF3N2O4 — CID 54411831
N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2-oxobutanamide (PubChem CID 54411831) has the molecular formula C11H8ClF3N2O4 and a molecular weight of 324.64 g/mol. Its IUPAC name is N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2-oxobutanamide.
| Compound Name | N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2-oxobutanamide |
|---|---|
| PubChem CID | 54411831 |
| Molecular Formula | C11H8ClF3N2O4 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2-oxobutanamide |
| SMILES | CCC(=O)C(=O)Nc1cc(C(F)(F)F)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8ClF3N2O4/c1-2-9(18)10(19)16-7-3-5(11(13,14)15)6(12)4-8(7)17(20)21/h3-4H,2H2,1H3,(H,16,19) |
| InChIKey | VURCVVLSXPBHNA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|