C12H9ClF3N3O2S — CID 55830936
5-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 55830936) has the molecular formula C12H9ClF3N3O2S and a molecular weight of 351.74 g/mol. Its IUPAC name is 5-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | 5-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 55830936 |
| Molecular Formula | C12H9ClF3N3O2S |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 5-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | Cc1nc(CNc2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C12H9ClF3N3O2S/c1-6-18-7(5-22-6)4-17-10-3-9(13)8(12(14,15)16)2-11(10)19(20)21/h2-3,5,17H,4H2,1H3 |
| InChIKey | CVCDPHMCZRBKSP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|