C14H13ClF3N3O2S — CID 95354046
5-chloro-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 95354046) has the molecular formula C14H13ClF3N3O2S and a molecular weight of 379.79 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | 5-chloro-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 95354046 |
| Molecular Formula | C14H13ClF3N3O2S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 5-chloro-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | Cc1nc(C)c([C@H](C)Nc2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H13ClF3N3O2S/c1-6-13(24-8(3)19-6)7(2)20-11-5-10(15)9(14(16,17)18)4-12(11)21(22)23/h4-5,7,20H,1-3H3/t7-/m0/s1 |
| InChIKey | OHQXBKXTUDCFJW-ZETCQYMHSA-N |
| XLogP | 5.51 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|