C13H14FN3O2S — CID 63752593
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluoro-3-nitroaniline (PubChem CID 63752593) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluoro-3-nitroaniline.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluoro-3-nitroaniline |
|---|---|
| PubChem CID | 63752593 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluoro-3-nitroaniline |
| SMILES | Cc1nc(C)c(C(C)Nc2ccc(F)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C13H14FN3O2S/c1-7-13(20-9(3)15-7)8(2)16-10-4-5-11(14)12(6-10)17(18)19/h4-6,8,16H,1-3H3 |
| InChIKey | BUFPKYWBYPJOLH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|