C18H15ClF3N3O3 — CID 97020909
6-[(1S)-1-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 97020909) has the molecular formula C18H15ClF3N3O3 and a molecular weight of 413.78 g/mol. Its IUPAC name is 6-[(1S)-1-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(1S)-1-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 97020909 |
| Molecular Formula | C18H15ClF3N3O3 |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 6-[(1S)-1-[5-chloro-2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C[C@H](Nc1cc(Cl)c(C(F)(F)F)cc1[N+](=O)[O-])c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C18H15ClF3N3O3/c1-9(10-2-4-14-11(6-10)3-5-17(26)24-14)23-15-8-13(19)12(18(20,21)22)7-16(15)25(27)28/h2,4,6-9,23H,3,5H2,1H3,(H,24,26)/t9-/m0/s1 |
| InChIKey | AWLMJKBMSKMHRH-VIFPVBQESA-N |
| XLogP | 5.32 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|