C18H16N4O3 — CID 47054391
5-nitro-2-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethylamino]benzonitrile (PubChem CID 47054391) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 5-nitro-2-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethylamino]benzonitrile.
| Compound Name | 5-nitro-2-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 47054391 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 5-nitro-2-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc([N+](=O)[O-])cc1C#N)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C18H16N4O3/c1-11(12-2-5-16-13(8-12)3-7-18(23)21-16)20-17-6-4-15(22(24)25)9-14(17)10-19/h2,4-6,8-9,11,20H,3,7H2,1H3,(H,21,23) |
| InChIKey | LVLWJMFLBVLYBA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|