C16H14FN3O3 — CID 94182842
5-[(1R)-1-(4-fluoro-2-nitroanilino)ethyl]-1,3-dihydroindol-2-one (PubChem CID 94182842) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is 5-[(1R)-1-(4-fluoro-2-nitroanilino)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(1R)-1-(4-fluoro-2-nitroanilino)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 94182842 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 5-[(1R)-1-(4-fluoro-2-nitroanilino)ethyl]-1,3-dihydroindol-2-one |
| SMILES | C[C@@H](Nc1ccc(F)cc1[N+](=O)[O-])c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C16H14FN3O3/c1-9(10-2-4-13-11(6-10)7-16(21)19-13)18-14-5-3-12(17)8-15(14)20(22)23/h2-6,8-9,18H,7H2,1H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | CIRGZSNIVGMJLP-SECBINFHSA-N |
| XLogP | 3.40 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|