C17H16BrN3O3 — CID 78897834
6-[1-(4-bromo-2-nitroanilino)ethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 78897834) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 6-[1-(4-bromo-2-nitroanilino)ethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[1-(4-bromo-2-nitroanilino)ethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 78897834 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 6-[1-(4-bromo-2-nitroanilino)ethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(Nc1ccc(Br)cc1[N+](=O)[O-])c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H16BrN3O3/c1-10(19-15-6-4-13(18)9-16(15)21(23)24)11-2-5-14-12(8-11)3-7-17(22)20-14/h2,4-6,8-10,19H,3,7H2,1H3,(H,20,22) |
| InChIKey | IEIBKHAGGDFEKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|